C14H13N3O2 — CID 8811927
ethyl (2S)-2-cyano-3-[(S)-cyano(phenyl)methyl]iminopropanoate (PubChem CID 8811927) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is ethyl (2S)-2-cyano-3-[(S)-cyano(phenyl)methyl]iminopropanoate.
| Compound Name | ethyl (2S)-2-cyano-3-[(S)-cyano(phenyl)methyl]iminopropanoate |
|---|---|
| PubChem CID | 8811927 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | ethyl (2S)-2-cyano-3-[(S)-cyano(phenyl)methyl]iminopropanoate |
| SMILES | CCOC(=O)[C@H](C#N)/C=N/[C@H](C#N)c1ccccc1 |
| InChI | InChI=1S/C14H13N3O2/c1-2-19-14(18)12(8-15)10-17-13(9-16)11-6-4-3-5-7-11/h3-7,10,12-13H,2H2,1H3/b17-10+/t12-,13-/m1/s1 |
| InChIKey | VHQKIBVRYOZQII-HSFOFRNISA-N |
| XLogP | 2.02 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|