C18H18N2O2 — CID 8812800
ethyl (2R)-2-cyano-3-[(1S)-1-naphthalen-1-ylethyl]iminopropanoate (PubChem CID 8812800) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is ethyl (2R)-2-cyano-3-[(1S)-1-naphthalen-1-ylethyl]iminopropanoate.
| Compound Name | ethyl (2R)-2-cyano-3-[(1S)-1-naphthalen-1-ylethyl]iminopropanoate |
|---|---|
| PubChem CID | 8812800 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | ethyl (2R)-2-cyano-3-[(1S)-1-naphthalen-1-ylethyl]iminopropanoate |
| SMILES | CCOC(=O)[C@@H](C#N)/C=N/[C@@H](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H18N2O2/c1-3-22-18(21)15(11-19)12-20-13(2)16-10-6-8-14-7-4-5-9-17(14)16/h4-10,12-13,15H,3H2,1-2H3/b20-12+/t13-,15-/m0/s1 |
| InChIKey | CWTLPCGEUHJKJA-ATPOIVEZSA-N |
| XLogP | 3.67 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|