C19H26N3O3+ — CID 8812746
ethyl (2S)-2-cyano-3-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]iminopropanoate (PubChem CID 8812746) has the molecular formula C19H26N3O3+ and a molecular weight of 344.44 g/mol. Its IUPAC name is ethyl (2S)-2-cyano-3-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]iminopropanoate.
| Compound Name | ethyl (2S)-2-cyano-3-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]iminopropanoate |
|---|---|
| PubChem CID | 8812746 |
| Molecular Formula | C19H26N3O3+ |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | ethyl (2S)-2-cyano-3-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]iminopropanoate |
| SMILES | CCOC(=O)[C@H](C#N)/C=N/[C@H](C)[C@H](c1ccccc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C19H25N3O3/c1-3-25-19(23)17(13-20)14-21-15(2)18(16-7-5-4-6-8-16)22-9-11-24-12-10-22/h4-8,14-15,17-18H,3,9-12H2,1-2H3/p+1/b21-14+/t15-,17-,18-/m1/s1 |
| InChIKey | QLVHDLGUGZXDHN-ZMWBYSJSSA-O |
| XLogP | 0.80 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|