C22H21N3O2 — CID 8812264
ethyl (2R)-2-cyano-3-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]iminopropanoate (PubChem CID 8812264) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is ethyl (2R)-2-cyano-3-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]iminopropanoate.
| Compound Name | ethyl (2R)-2-cyano-3-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]iminopropanoate |
|---|---|
| PubChem CID | 8812264 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | ethyl (2R)-2-cyano-3-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]iminopropanoate |
| SMILES | CCOC(=O)[C@@H](C#N)/C=N/C[C@@H](c1ccccc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H21N3O2/c1-2-27-22(26)17(12-23)13-24-14-19(16-8-4-3-5-9-16)20-15-25-21-11-7-6-10-18(20)21/h3-11,13,15,17,19,25H,2,14H2,1H3/b24-13+/t17-,19-/m0/s1 |
| InChIKey | HXFYWCNLODKYLM-YMKFNUEJSA-N |
| XLogP | 4.07 |
| TPSA | 78.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|