C16H16Cl2N2O4 — CID 54253675
propan-2-yl 2,5-dichloro-3-[(2-cyano-3-ethoxy-3-oxopropylidene)amino]benzoate (PubChem CID 54253675) has the molecular formula C16H16Cl2N2O4 and a molecular weight of 371.22 g/mol. Its IUPAC name is propan-2-yl 2,5-dichloro-3-[(2-cyano-3-ethoxy-3-oxopropylidene)amino]benzoate.
| Compound Name | propan-2-yl 2,5-dichloro-3-[(2-cyano-3-ethoxy-3-oxopropylidene)amino]benzoate |
|---|---|
| PubChem CID | 54253675 |
| Molecular Formula | C16H16Cl2N2O4 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | propan-2-yl 2,5-dichloro-3-[(2-cyano-3-ethoxy-3-oxopropylidene)amino]benzoate |
| SMILES | CCOC(=O)C(C#N)/C=N/c1cc(Cl)cc(C(=O)OC(C)C)c1Cl |
| InChI | InChI=1S/C16H16Cl2N2O4/c1-4-23-15(21)10(7-19)8-20-13-6-11(17)5-12(14(13)18)16(22)24-9(2)3/h5-6,8-10H,4H2,1-3H3/b20-8+ |
| InChIKey | QYNKQNIVJSAVOY-DNTJNYDQSA-N |
| XLogP | 3.96 |
| TPSA | 88.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|