C15H16ClN3O3 — CID 54079986
ethyl N-[3-(4-chloro-2,6-dimethylphenyl)imino-2-cyanopropanoyl]carbamate (PubChem CID 54079986) has the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. Its IUPAC name is ethyl N-[3-(4-chloro-2,6-dimethylphenyl)imino-2-cyanopropanoyl]carbamate.
| Compound Name | ethyl N-[3-(4-chloro-2,6-dimethylphenyl)imino-2-cyanopropanoyl]carbamate |
|---|---|
| PubChem CID | 54079986 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | ethyl N-[3-(4-chloro-2,6-dimethylphenyl)imino-2-cyanopropanoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)/C=N/c1c(C)cc(Cl)cc1C |
| InChI | InChI=1S/C15H16ClN3O3/c1-4-22-15(21)19-14(20)11(7-17)8-18-13-9(2)5-12(16)6-10(13)3/h5-6,8,11H,4H2,1-3H3,(H,19,20,21)/b18-8+ |
| InChIKey | MMKNKEBLYIKGOX-QGMBQPNBSA-N |
| XLogP | 3.07 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|