C11H12Cl2N2O2 — CID 91733961
methyl 2,5-dichloro-3-(dimethylaminomethylideneamino)benzoate (PubChem CID 91733961) has the molecular formula C11H12Cl2N2O2 and a molecular weight of 275.14 g/mol. Its IUPAC name is methyl 2,5-dichloro-3-(dimethylaminomethylideneamino)benzoate.
| Compound Name | methyl 2,5-dichloro-3-(dimethylaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 91733961 |
| Molecular Formula | C11H12Cl2N2O2 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | methyl 2,5-dichloro-3-(dimethylaminomethylideneamino)benzoate |
| SMILES | COC(=O)c1cc(Cl)cc(/N=C/N(C)C)c1Cl |
| InChI | InChI=1S/C11H12Cl2N2O2/c1-15(2)6-14-9-5-7(12)4-8(10(9)13)11(16)17-3/h4-6H,1-3H3/b14-6+ |
| InChIKey | HYZFQWSMJIFMQX-MKMNVTDBSA-N |
| XLogP | 3.00 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|