C13H18N2O4 — CID 163275550
methyl 2-(dimethylaminomethylideneamino)-4,5-dimethoxybenzoate (PubChem CID 163275550) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is methyl 2-(dimethylaminomethylideneamino)-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-(dimethylaminomethylideneamino)-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 163275550 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | methyl 2-(dimethylaminomethylideneamino)-4,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1/N=C/N(C)C |
| InChI | InChI=1S/C13H18N2O4/c1-15(2)8-14-10-7-12(18-4)11(17-3)6-9(10)13(16)19-5/h6-8H,1-5H3/b14-8+ |
| InChIKey | SWUQXRPZFUSVIS-RIYZIHGNSA-N |
| XLogP | 1.71 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|