C16H19N3O4 — CID 69372859
methyl 2-(dimethylaminomethylideneamino)-6,7-dimethoxyquinoline-3-carboxylate (PubChem CID 69372859) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is methyl 2-(dimethylaminomethylideneamino)-6,7-dimethoxyquinoline-3-carboxylate.
| Compound Name | methyl 2-(dimethylaminomethylideneamino)-6,7-dimethoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 69372859 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | methyl 2-(dimethylaminomethylideneamino)-6,7-dimethoxyquinoline-3-carboxylate |
| SMILES | COC(=O)c1cc2cc(OC)c(OC)cc2nc1N=CN(C)C |
| InChI | InChI=1S/C16H19N3O4/c1-19(2)9-17-15-11(16(20)23-5)6-10-7-13(21-3)14(22-4)8-12(10)18-15/h6-9H,1-5H3 |
| InChIKey | FJKYQCVZJHEOOR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 73.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|