C15H22N2O2 — CID 18738662
methyl 2-(dimethylaminomethylideneamino)-3,4,5,6-tetramethylbenzoate (PubChem CID 18738662) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is methyl 2-(dimethylaminomethylideneamino)-3,4,5,6-tetramethylbenzoate.
| Compound Name | methyl 2-(dimethylaminomethylideneamino)-3,4,5,6-tetramethylbenzoate |
|---|---|
| PubChem CID | 18738662 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | methyl 2-(dimethylaminomethylideneamino)-3,4,5,6-tetramethylbenzoate |
| SMILES | COC(=O)c1c(C)c(C)c(C)c(C)c1/N=C/N(C)C |
| InChI | InChI=1S/C15H22N2O2/c1-9-10(2)12(4)14(16-8-17(5)6)13(11(9)3)15(18)19-7/h8H,1-7H3/b16-8+ |
| InChIKey | UPGLCUIZROCGQD-LZYBPNLTSA-N |
| XLogP | 2.93 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|