C13H13Cl2NO3 — CID 135499007
ethyl 2-[(3,5-dichlorophenyl)iminomethyl]-3-hydroxybut-2-enoate (PubChem CID 135499007) has the molecular formula C13H13Cl2NO3 and a molecular weight of 302.16 g/mol. Its IUPAC name is ethyl 2-[(3,5-dichlorophenyl)iminomethyl]-3-hydroxybut-2-enoate.
| Compound Name | ethyl 2-[(3,5-dichlorophenyl)iminomethyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135499007 |
| Molecular Formula | C13H13Cl2NO3 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | ethyl 2-[(3,5-dichlorophenyl)iminomethyl]-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1cc(Cl)cc(Cl)c1)=C(C)O |
| InChI | InChI=1S/C13H13Cl2NO3/c1-3-19-13(18)12(8(2)17)7-16-11-5-9(14)4-10(15)6-11/h4-7,17H,3H2,1-2H3/b12-8?,16-7+ |
| InChIKey | BUZHFHWDCQGZEE-HLJJAJRYSA-N |
| XLogP | 4.09 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|