C16H19ClFNO3 — CID 176977131
ethyl (Z)-2-[(4-chloro-2-fluorophenyl)iminomethyl]-3-hydroxy-4-methylhex-2-enoate (PubChem CID 176977131) has the molecular formula C16H19ClFNO3 and a molecular weight of 327.78 g/mol. Its IUPAC name is ethyl (Z)-2-[(4-chloro-2-fluorophenyl)iminomethyl]-3-hydroxy-4-methylhex-2-enoate.
| Compound Name | ethyl (Z)-2-[(4-chloro-2-fluorophenyl)iminomethyl]-3-hydroxy-4-methylhex-2-enoate |
|---|---|
| PubChem CID | 176977131 |
| Molecular Formula | C16H19ClFNO3 |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | ethyl (Z)-2-[(4-chloro-2-fluorophenyl)iminomethyl]-3-hydroxy-4-methylhex-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1ccc(Cl)cc1F)=C(\O)C(C)CC |
| InChI | InChI=1S/C16H19ClFNO3/c1-4-10(3)15(20)12(16(21)22-5-2)9-19-14-7-6-11(17)8-13(14)18/h6-10,20H,4-5H2,1-3H3/b15-12-,19-9+ |
| InChIKey | QIUSXQSIUWIVGL-FDWAVUOXSA-N |
| XLogP | 4.60 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|