C26H15F4NO6 — CID 135414504
ethyl (Z)-3-hydroxy-2-[(3-hydroxy-9,10-dioxoanthracen-2-yl)iminomethyl]-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate (PubChem CID 135414504) has the molecular formula C26H15F4NO6 and a molecular weight of 513.40 g/mol. Its IUPAC name is ethyl (Z)-3-hydroxy-2-[(3-hydroxy-9,10-dioxoanthracen-2-yl)iminomethyl]-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate.
| Compound Name | ethyl (Z)-3-hydroxy-2-[(3-hydroxy-9,10-dioxoanthracen-2-yl)iminomethyl]-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 135414504 |
| Molecular Formula | C26H15F4NO6 |
| Molecular Weight | 513.40 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | ethyl (Z)-3-hydroxy-2-[(3-hydroxy-9,10-dioxoanthracen-2-yl)iminomethyl]-3-(2,3,4,5-tetrafluorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1cc2c(cc1O)C(=O)c1ccccc1C2=O)=C(\O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C26H15F4NO6/c1-2-37-26(36)16(25(35)15-7-17(27)21(29)22(30)20(15)28)10-31-18-8-13-14(9-19(18)32)24(34)12-6-4-3-5-11(12)23(13)33/h3-10,32,35H,2H2,1H3/b25-16-,31-10+ |
| InChIKey | PMYNRTQIQOADKW-KXJIWPKXSA-N |
| XLogP | 4.96 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|