C22H16F3NO4 — CID 152772361
ethyl 3-hydroxy-2-[(3-hydroxynaphthalen-2-yl)iminomethyl]-3-(2,3,5-trifluorophenyl)prop-2-enoate (PubChem CID 152772361) has the molecular formula C22H16F3NO4 and a molecular weight of 415.37 g/mol. Its IUPAC name is ethyl 3-hydroxy-2-[(3-hydroxynaphthalen-2-yl)iminomethyl]-3-(2,3,5-trifluorophenyl)prop-2-enoate.
| Compound Name | ethyl 3-hydroxy-2-[(3-hydroxynaphthalen-2-yl)iminomethyl]-3-(2,3,5-trifluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 152772361 |
| Molecular Formula | C22H16F3NO4 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | ethyl 3-hydroxy-2-[(3-hydroxynaphthalen-2-yl)iminomethyl]-3-(2,3,5-trifluorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1cc2ccccc2cc1O)=C(O)c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C22H16F3NO4/c1-2-30-22(29)16(21(28)15-9-14(23)10-17(24)20(15)25)11-26-18-7-12-5-3-4-6-13(12)8-19(18)27/h3-11,27-28H,2H2,1H3/b21-16?,26-11+ |
| InChIKey | VXHTXMQBIPZGJX-NEWDKLMGSA-N |
| XLogP | 5.20 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|