C16H11Cl2F2N3O3 — CID 173292147
ethyl 3-(2,6-dichloro-5-fluoro-3-pyridinyl)-2-[(3-fluoro-4-pyridinyl)iminomethyl]-3-hydroxyprop-2-enoate (PubChem CID 173292147) has the molecular formula C16H11Cl2F2N3O3 and a molecular weight of 402.18 g/mol. Its IUPAC name is ethyl 3-(2,6-dichloro-5-fluoro-3-pyridinyl)-2-[(3-fluoro-4-pyridinyl)iminomethyl]-3-hydroxyprop-2-enoate.
| Compound Name | ethyl 3-(2,6-dichloro-5-fluoro-3-pyridinyl)-2-[(3-fluoro-4-pyridinyl)iminomethyl]-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 173292147 |
| Molecular Formula | C16H11Cl2F2N3O3 |
| Molecular Weight | 402.18 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | ethyl 3-(2,6-dichloro-5-fluoro-3-pyridinyl)-2-[(3-fluoro-4-pyridinyl)iminomethyl]-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1ccncc1F)=C(O)c1cc(F)c(Cl)nc1Cl |
| InChI | InChI=1S/C16H11Cl2F2N3O3/c1-2-26-16(25)9(6-22-12-3-4-21-7-11(12)20)13(24)8-5-10(19)15(18)23-14(8)17/h3-7,24H,2H2,1H3/b13-9?,22-6+ |
| InChIKey | IPUUZBDSJCTROF-DEROFUEJSA-N |
| XLogP | 4.30 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.18 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|