C20H14Cl2FN3O3 — CID 135464540
ethyl (E)-3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-hydroxy-2-(quinolin-6-yliminomethyl)prop-2-enoate (PubChem CID 135464540) has the molecular formula C20H14Cl2FN3O3 and a molecular weight of 434.25 g/mol. Its IUPAC name is ethyl (E)-3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-hydroxy-2-(quinolin-6-yliminomethyl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-hydroxy-2-(quinolin-6-yliminomethyl)prop-2-enoate |
|---|---|
| PubChem CID | 135464540 |
| Molecular Formula | C20H14Cl2FN3O3 |
| Molecular Weight | 434.25 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | ethyl (E)-3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-hydroxy-2-(quinolin-6-yliminomethyl)prop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1ccc2ncccc2c1)=C(/O)c1cc(F)c(Cl)nc1Cl |
| InChI | InChI=1S/C20H14Cl2FN3O3/c1-2-29-20(28)14(17(27)13-9-15(23)19(22)26-18(13)21)10-25-12-5-6-16-11(8-12)4-3-7-24-16/h3-10,27H,2H2,1H3/b17-14+,25-10+ |
| InChIKey | UMUWURAQVVEHKJ-MQCKUHELSA-N |
| XLogP | 5.31 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.25 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|