C25H23FN2O3 — CID 135434068
ethyl (Z)-2-[(3,4-dimethylphenyl)iminomethyl]-3-(2-fluoro-4-pyridin-4-ylphenyl)-3-hydroxyprop-2-enoate (PubChem CID 135434068) has the molecular formula C25H23FN2O3 and a molecular weight of 418.47 g/mol. Its IUPAC name is ethyl (Z)-2-[(3,4-dimethylphenyl)iminomethyl]-3-(2-fluoro-4-pyridin-4-ylphenyl)-3-hydroxyprop-2-enoate.
| Compound Name | ethyl (Z)-2-[(3,4-dimethylphenyl)iminomethyl]-3-(2-fluoro-4-pyridin-4-ylphenyl)-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 135434068 |
| Molecular Formula | C25H23FN2O3 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | ethyl (Z)-2-[(3,4-dimethylphenyl)iminomethyl]-3-(2-fluoro-4-pyridin-4-ylphenyl)-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1ccc(C)c(C)c1)=C(\O)c1ccc(-c2ccncc2)cc1F |
| InChI | InChI=1S/C25H23FN2O3/c1-4-31-25(30)22(15-28-20-7-5-16(2)17(3)13-20)24(29)21-8-6-19(14-23(21)26)18-9-11-27-12-10-18/h5-15,29H,4H2,1-3H3/b24-22-,28-15+ |
| InChIKey | ZVIRNEUQTKADFG-JUQWFJRLSA-N |
| XLogP | 5.74 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|