C18H14BrClFNO3 — CID 149163520
ethyl 3-(4-bromo-2-chlorophenyl)-2-[(4-fluorophenyl)iminomethyl]-3-hydroxyprop-2-enoate (PubChem CID 149163520) has the molecular formula C18H14BrClFNO3 and a molecular weight of 426.67 g/mol. Its IUPAC name is ethyl 3-(4-bromo-2-chlorophenyl)-2-[(4-fluorophenyl)iminomethyl]-3-hydroxyprop-2-enoate.
| Compound Name | ethyl 3-(4-bromo-2-chlorophenyl)-2-[(4-fluorophenyl)iminomethyl]-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 149163520 |
| Molecular Formula | C18H14BrClFNO3 |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 424.98 |
| IUPAC Name | ethyl 3-(4-bromo-2-chlorophenyl)-2-[(4-fluorophenyl)iminomethyl]-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1ccc(F)cc1)=C(O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C18H14BrClFNO3/c1-2-25-18(24)15(10-22-13-6-4-12(21)5-7-13)17(23)14-8-3-11(19)9-16(14)20/h3-10,23H,2H2,1H3/b17-15?,22-10+ |
| InChIKey | BFLUHFXIIJVQDX-NLONAJMXSA-N |
| XLogP | 5.48 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|