C20H15ClF3NO4 — CID 135672118
ethyl (E)-2-[(2-benzoyl-4-chlorophenyl)iminomethyl]-4,4,4-trifluoro-3-hydroxybut-2-enoate (PubChem CID 135672118) has the molecular formula C20H15ClF3NO4 and a molecular weight of 425.79 g/mol. Its IUPAC name is ethyl (E)-2-[(2-benzoyl-4-chlorophenyl)iminomethyl]-4,4,4-trifluoro-3-hydroxybut-2-enoate.
| Compound Name | ethyl (E)-2-[(2-benzoyl-4-chlorophenyl)iminomethyl]-4,4,4-trifluoro-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135672118 |
| Molecular Formula | C20H15ClF3NO4 |
| Molecular Weight | 425.79 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | ethyl (E)-2-[(2-benzoyl-4-chlorophenyl)iminomethyl]-4,4,4-trifluoro-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1ccc(Cl)cc1C(=O)c1ccccc1)=C(/O)C(F)(F)F |
| InChI | InChI=1S/C20H15ClF3NO4/c1-2-29-19(28)15(18(27)20(22,23)24)11-25-16-9-8-13(21)10-14(16)17(26)12-6-4-3-5-7-12/h3-11,27H,2H2,1H3/b18-15+,25-11+ |
| InChIKey | HEQQRBQKSJLWTI-KPUFISACSA-N |
| XLogP | 5.21 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.79 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|