C17H24O3SSe — CID 11079594
S-ethyl (E)-3,4-diethoxy-5-phenylselanylpent-4-enethioate (PubChem CID 11079594) has the molecular formula C17H24O3SSe and a molecular weight of 387.40 g/mol. Its IUPAC name is S-ethyl (E)-3,4-diethoxy-5-phenylselanylpent-4-enethioate.
| Compound Name | S-ethyl (E)-3,4-diethoxy-5-phenylselanylpent-4-enethioate |
|---|---|
| PubChem CID | 11079594 |
| Molecular Formula | C17H24O3SSe |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | S-ethyl (E)-3,4-diethoxy-5-phenylselanylpent-4-enethioate |
| SMILES | CCO/C(=C/[Se]c1ccccc1)C(CC(=O)SCC)OCC |
| InChI | InChI=1S/C17H24O3SSe/c1-4-19-15(12-17(18)21-6-3)16(20-5-2)13-22-14-10-8-7-9-11-14/h7-11,13,15H,4-6,12H2,1-3H3/b16-13+ |
| InChIKey | HMWMMEHSKCERFH-DTQAZKPQSA-N |
| XLogP | 2.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|