C19H20O3Se — CID 11036153
3-ethoxy-1-phenyl-5-phenylselanylpentane-1,4-dione (PubChem CID 11036153) has the molecular formula C19H20O3Se and a molecular weight of 375.33 g/mol. Its IUPAC name is 3-ethoxy-1-phenyl-5-phenylselanylpentane-1,4-dione.
| Compound Name | 3-ethoxy-1-phenyl-5-phenylselanylpentane-1,4-dione |
|---|---|
| PubChem CID | 11036153 |
| Molecular Formula | C19H20O3Se |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 3-ethoxy-1-phenyl-5-phenylselanylpentane-1,4-dione |
| SMILES | CCOC(CC(=O)c1ccccc1)C(=O)C[Se]c1ccccc1 |
| InChI | InChI=1S/C19H20O3Se/c1-2-22-19(13-17(20)15-9-5-3-6-10-15)18(21)14-23-16-11-7-4-8-12-16/h3-12,19H,2,13-14H2,1H3 |
| InChIKey | FNHDEZQDLHJLHB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|