C24H27ClO3P+ — CID 126960654
(1,2-diethoxy-2-oxoethyl)-triphenylphosphanium;hydrochloride (PubChem CID 126960654) has the molecular formula C24H27ClO3P+ and a molecular weight of 429.90 g/mol. Its IUPAC name is (1,2-diethoxy-2-oxoethyl)-triphenylphosphanium;hydrochloride.
| Compound Name | (1,2-diethoxy-2-oxoethyl)-triphenylphosphanium;hydrochloride |
|---|---|
| PubChem CID | 126960654 |
| Molecular Formula | C24H27ClO3P+ |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (1,2-diethoxy-2-oxoethyl)-triphenylphosphanium;hydrochloride |
| SMILES | CCOC(=O)C(OCC)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C24H26O3P.ClH/c1-3-26-23(25)24(27-4-2)28(20-14-8-5-9-15-20,21-16-10-6-11-17-21)22-18-12-7-13-19-22;/h5-19,24H,3-4H2,1-2H3;1H/q+1; |
| InChIKey | MMJCDOWKUCLEQX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|