C24H34O4Se — CID 11751642
1-O-ethyl 5-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-methylidene-4-phenylselanylpentanedioate (PubChem CID 11751642) has the molecular formula C24H34O4Se and a molecular weight of 465.49 g/mol. Its IUPAC name is 1-O-ethyl 5-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-methylidene-4-phenylselanylpentanedioate.
| Compound Name | 1-O-ethyl 5-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-methylidene-4-phenylselanylpentanedioate |
|---|---|
| PubChem CID | 11751642 |
| Molecular Formula | C24H34O4Se |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 1-O-ethyl 5-O-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-methylidene-4-phenylselanylpentanedioate |
| SMILES | C=C(CC([Se]c1ccccc1)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)C(=O)OCC |
| InChI | InChI=1S/C24H34O4Se/c1-6-27-23(25)18(5)15-22(29-19-10-8-7-9-11-19)24(26)28-21-14-17(4)12-13-20(21)16(2)3/h7-11,16-17,20-22H,5-6,12-15H2,1-4H3/t17-,20+,21-,22?/m1/s1 |
| InChIKey | SUVUJSKBQDVAJL-LLXXINJRSA-N |
| XLogP | 4.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|