C14H23BrO2 — CID 11779730
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(bromomethyl)prop-2-enoate (PubChem CID 11779730) has the molecular formula C14H23BrO2 and a molecular weight of 303.24 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(bromomethyl)prop-2-enoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(bromomethyl)prop-2-enoate |
|---|---|
| PubChem CID | 11779730 |
| Molecular Formula | C14H23BrO2 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(bromomethyl)prop-2-enoate |
| SMILES | C=C(CBr)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C14H23BrO2/c1-9(2)12-6-5-10(3)7-13(12)17-14(16)11(4)8-15/h9-10,12-13H,4-8H2,1-3H3/t10-,12+,13-/m1/s1 |
| InChIKey | MRHIMQGGRGBHPF-KGYLQXTDSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|