C13H21FO2 — CID 69329469
(5-methyl-2-propan-2-ylcyclohexyl) 2-fluoroprop-2-enoate (PubChem CID 69329469) has the molecular formula C13H21FO2 and a molecular weight of 228.31 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-fluoroprop-2-enoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 69329469 |
| Molecular Formula | C13H21FO2 |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-fluoroprop-2-enoate |
| SMILES | C=C(F)C(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C13H21FO2/c1-8(2)11-6-5-9(3)7-12(11)16-13(15)10(4)14/h8-9,11-12H,4-7H2,1-3H3 |
| InChIKey | MDONCECXIWPCKV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|