C13H22N2O2 — CID 135442240
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-diazopropanoate (PubChem CID 135442240) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-diazopropanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-diazopropanoate |
|---|---|
| PubChem CID | 135442240 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-diazopropanoate |
| SMILES | CC(=[N+]=[N-])C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C13H22N2O2/c1-8(2)11-6-5-9(3)7-12(11)17-13(16)10(4)15-14/h8-9,11-12H,5-7H2,1-4H3/t9-,11+,12-/m1/s1 |
| InChIKey | NAENKYWWDNFOEJ-ADEWGFFLSA-N |
| XLogP | 2.68 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|