C14H25NO3 — CID 25196076
(5-methyl-2-propan-2-ylcyclohexyl) 2-(ethylamino)-2-oxoacetate (PubChem CID 25196076) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-(ethylamino)-2-oxoacetate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(ethylamino)-2-oxoacetate |
|---|---|
| PubChem CID | 25196076 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(ethylamino)-2-oxoacetate |
| SMILES | CCNC(=O)C(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C14H25NO3/c1-5-15-13(16)14(17)18-12-8-10(4)6-7-11(12)9(2)3/h9-12H,5-8H2,1-4H3,(H,15,16) |
| InChIKey | VTSKTHILUKZQTB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|