C28H28F2N2O — CID 22840508
(E)-3-[(1S)-2,2-bis(3-fluorophenyl)cyclopropyl]-N-[4-(6-methyl-3-pyridinyl)butyl]prop-2-enamide (PubChem CID 22840508) has the molecular formula C28H28F2N2O and a molecular weight of 446.54 g/mol. Its IUPAC name is (E)-3-[(1S)-2,2-bis(3-fluorophenyl)cyclopropyl]-N-[4-(6-methyl-3-pyridinyl)butyl]prop-2-enamide.
| Compound Name | (E)-3-[(1S)-2,2-bis(3-fluorophenyl)cyclopropyl]-N-[4-(6-methyl-3-pyridinyl)butyl]prop-2-enamide |
|---|---|
| PubChem CID | 22840508 |
| Molecular Formula | C28H28F2N2O |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | (E)-3-[(1S)-2,2-bis(3-fluorophenyl)cyclopropyl]-N-[4-(6-methyl-3-pyridinyl)butyl]prop-2-enamide |
| SMILES | Cc1ccc(CCCCNC(=O)/C=C/[C@@H]2CC2(c2cccc(F)c2)c2cccc(F)c2)cn1 |
| InChI | InChI=1S/C28H28F2N2O/c1-20-11-12-21(19-32-20)6-2-3-15-31-27(33)14-13-24-18-28(24,22-7-4-9-25(29)16-22)23-8-5-10-26(30)17-23/h4-5,7-14,16-17,19,24H,2-3,6,15,18H2,1H3,(H,31,33)/b14-13+/t24-/m1/s1 |
| InChIKey | WPMGMCGCTWRHFT-XIQMRYHBSA-N |
| XLogP | 5.67 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|