C27H27F2NOS — CID 57080889
3-[(1R)-2,2-bis(3-fluorophenyl)cyclopropyl]-N-[(2S)-5-thiophen-3-ylpentan-2-yl]prop-2-enamide (PubChem CID 57080889) has the molecular formula C27H27F2NOS and a molecular weight of 451.58 g/mol. Its IUPAC name is 3-[(1R)-2,2-bis(3-fluorophenyl)cyclopropyl]-N-[(2S)-5-thiophen-3-ylpentan-2-yl]prop-2-enamide.
| Compound Name | 3-[(1R)-2,2-bis(3-fluorophenyl)cyclopropyl]-N-[(2S)-5-thiophen-3-ylpentan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 57080889 |
| Molecular Formula | C27H27F2NOS |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 3-[(1R)-2,2-bis(3-fluorophenyl)cyclopropyl]-N-[(2S)-5-thiophen-3-ylpentan-2-yl]prop-2-enamide |
| SMILES | C[C@@H](CCCc1ccsc1)NC(=O)C=C[C@H]1CC1(c1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C27H27F2NOS/c1-19(5-2-6-20-13-14-32-18-20)30-26(31)12-11-23-17-27(23,21-7-3-9-24(28)15-21)22-8-4-10-25(29)16-22/h3-4,7-16,18-19,23H,2,5-6,17H2,1H3,(H,30,31)/t19-,23-/m0/s1 |
| InChIKey | OYQZBLRWUDZAOH-CVDCTZTESA-N |
| XLogP | 6.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|