C26H35NO2S — CID 54039814
5-(4-methoxyphenyl)-N-[(2R)-5-thiophen-3-ylpentan-2-yl]deca-2,4-dienamide (PubChem CID 54039814) has the molecular formula C26H35NO2S and a molecular weight of 425.64 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-N-[(2R)-5-thiophen-3-ylpentan-2-yl]deca-2,4-dienamide.
| Compound Name | 5-(4-methoxyphenyl)-N-[(2R)-5-thiophen-3-ylpentan-2-yl]deca-2,4-dienamide |
|---|---|
| PubChem CID | 54039814 |
| Molecular Formula | C26H35NO2S |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 5-(4-methoxyphenyl)-N-[(2R)-5-thiophen-3-ylpentan-2-yl]deca-2,4-dienamide |
| SMILES | CCCCCC(=CC=CC(=O)N[C@H](C)CCCc1ccsc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H35NO2S/c1-4-5-6-11-23(24-14-16-25(29-3)17-15-24)12-8-13-26(28)27-21(2)9-7-10-22-18-19-30-20-22/h8,12-21H,4-7,9-11H2,1-3H3,(H,27,28)/t21-/m1/s1 |
| InChIKey | LLNPWLJTOWMMNU-OAQYLSRUSA-N |
| XLogP | 6.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|