C33H40N2O7 — CID 54410484
N-[(2R)-5-pyridin-3-ylpentan-2-yl]-5,5-bis(3,4,5-trimethoxyphenyl)penta-2,4-dienamide (PubChem CID 54410484) has the molecular formula C33H40N2O7 and a molecular weight of 576.69 g/mol. Its IUPAC name is N-[(2R)-5-pyridin-3-ylpentan-2-yl]-5,5-bis(3,4,5-trimethoxyphenyl)penta-2,4-dienamide.
| Compound Name | N-[(2R)-5-pyridin-3-ylpentan-2-yl]-5,5-bis(3,4,5-trimethoxyphenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 54410484 |
| Molecular Formula | C33H40N2O7 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | N-[(2R)-5-pyridin-3-ylpentan-2-yl]-5,5-bis(3,4,5-trimethoxyphenyl)penta-2,4-dienamide |
| SMILES | COc1cc(C(=CC=CC(=O)N[C@H](C)CCCc2cccnc2)c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C33H40N2O7/c1-22(11-8-12-23-13-10-16-34-21-23)35-31(36)15-9-14-26(24-17-27(37-2)32(41-6)28(18-24)38-3)25-19-29(39-4)33(42-7)30(20-25)40-5/h9-10,13-22H,8,11-12H2,1-7H3,(H,35,36)/t22-/m1/s1 |
| InChIKey | VTTXNGAMGCJYQA-JOCHJYFZSA-N |
| XLogP | 5.65 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|