C26H35N3O — CID 22840709
(2E,4E)-5-pyridin-3-yl-N-[(2R)-5-pyridin-3-ylpentan-2-yl]undeca-2,4-dienamide (PubChem CID 22840709) has the molecular formula C26H35N3O and a molecular weight of 405.59 g/mol. Its IUPAC name is (2E,4E)-5-pyridin-3-yl-N-[(2R)-5-pyridin-3-ylpentan-2-yl]undeca-2,4-dienamide.
| Compound Name | (2E,4E)-5-pyridin-3-yl-N-[(2R)-5-pyridin-3-ylpentan-2-yl]undeca-2,4-dienamide |
|---|---|
| PubChem CID | 22840709 |
| Molecular Formula | C26H35N3O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | (2E,4E)-5-pyridin-3-yl-N-[(2R)-5-pyridin-3-ylpentan-2-yl]undeca-2,4-dienamide |
| SMILES | CCCCCC/C(=C\C=C\C(=O)N[C@H](C)CCCc1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C26H35N3O/c1-3-4-5-6-14-24(25-16-10-19-28-21-25)15-8-17-26(30)29-22(2)11-7-12-23-13-9-18-27-20-23/h8-10,13,15-22H,3-7,11-12,14H2,1-2H3,(H,29,30)/b17-8+,24-15+/t22-/m1/s1 |
| InChIKey | VDOVWGMUBLYAMD-ILJIAISRSA-N |
| XLogP | 5.91 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|