C28H30N2O2 — CID 54386374
5-(4-methoxyphenyl)-5-phenyl-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide (PubChem CID 54386374) has the molecular formula C28H30N2O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-5-phenyl-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide.
| Compound Name | 5-(4-methoxyphenyl)-5-phenyl-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 54386374 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 5-(4-methoxyphenyl)-5-phenyl-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide |
| SMILES | COc1ccc(C(=CC=CC(=O)N[C@H](C)CCCc2cccnc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H30N2O2/c1-22(9-6-10-23-11-8-20-29-21-23)30-28(31)15-7-14-27(24-12-4-3-5-13-24)25-16-18-26(32-2)19-17-25/h3-5,7-8,11-22H,6,9-10H2,1-2H3,(H,30,31)/t22-/m1/s1 |
| InChIKey | VDNHRLWFBHTMGP-JOCHJYFZSA-N |
| XLogP | 5.61 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|