C33H38N2O3 — CID 57019933
N-[(1R)-1-cyclopentyl-4-pyridin-3-ylbutyl]-5,5-bis(4-methoxyphenyl)penta-2,4-dienamide (PubChem CID 57019933) has the molecular formula C33H38N2O3 and a molecular weight of 510.68 g/mol. Its IUPAC name is N-[(1R)-1-cyclopentyl-4-pyridin-3-ylbutyl]-5,5-bis(4-methoxyphenyl)penta-2,4-dienamide.
| Compound Name | N-[(1R)-1-cyclopentyl-4-pyridin-3-ylbutyl]-5,5-bis(4-methoxyphenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 57019933 |
| Molecular Formula | C33H38N2O3 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | N-[(1R)-1-cyclopentyl-4-pyridin-3-ylbutyl]-5,5-bis(4-methoxyphenyl)penta-2,4-dienamide |
| SMILES | COc1ccc(C(=CC=CC(=O)N[C@H](CCCc2cccnc2)C2CCCC2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H38N2O3/c1-37-29-19-15-26(16-20-29)31(27-17-21-30(38-2)22-18-27)12-6-14-33(36)35-32(28-10-3-4-11-28)13-5-8-25-9-7-23-34-24-25/h6-7,9,12,14-24,28,32H,3-5,8,10-11,13H2,1-2H3,(H,35,36)/t32-/m1/s1 |
| InChIKey | QWEYHNYMNWYTTI-JGCGQSQUSA-N |
| XLogP | 6.78 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|