C30H34N2O3 — CID 86742538
(E)-3-[(1R)-2,2-bis(3-methoxyphenyl)cyclopropyl]-N-[(2S)-5-pyridin-3-ylpentan-2-yl]prop-2-enamide (PubChem CID 86742538) has the molecular formula C30H34N2O3 and a molecular weight of 470.61 g/mol. Its IUPAC name is (E)-3-[(1R)-2,2-bis(3-methoxyphenyl)cyclopropyl]-N-[(2S)-5-pyridin-3-ylpentan-2-yl]prop-2-enamide.
| Compound Name | (E)-3-[(1R)-2,2-bis(3-methoxyphenyl)cyclopropyl]-N-[(2S)-5-pyridin-3-ylpentan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 86742538 |
| Molecular Formula | C30H34N2O3 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | (E)-3-[(1R)-2,2-bis(3-methoxyphenyl)cyclopropyl]-N-[(2S)-5-pyridin-3-ylpentan-2-yl]prop-2-enamide |
| SMILES | COc1cccc(C2(c3cccc(OC)c3)C[C@@H]2/C=C/C(=O)N[C@@H](C)CCCc2cccnc2)c1 |
| InChI | InChI=1S/C30H34N2O3/c1-22(8-4-9-23-10-7-17-31-21-23)32-29(33)16-15-26-20-30(26,24-11-5-13-27(18-24)34-2)25-12-6-14-28(19-25)35-3/h5-7,10-19,21-22,26H,4,8-9,20H2,1-3H3,(H,32,33)/b16-15+/t22-,26-/m0/s1 |
| InChIKey | PJPPYXSWPWYICJ-UKYWXXMFSA-N |
| XLogP | 5.49 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|