C28H33N3O3 — CID 57158870
3-[(1R)-2,2-bis(3-methoxyphenyl)cyclopropyl]-N-[(2S)-5-(1H-imidazol-2-yl)pentan-2-yl]prop-2-enamide (PubChem CID 57158870) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is 3-[(1R)-2,2-bis(3-methoxyphenyl)cyclopropyl]-N-[(2S)-5-(1H-imidazol-2-yl)pentan-2-yl]prop-2-enamide.
| Compound Name | 3-[(1R)-2,2-bis(3-methoxyphenyl)cyclopropyl]-N-[(2S)-5-(1H-imidazol-2-yl)pentan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 57158870 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 3-[(1R)-2,2-bis(3-methoxyphenyl)cyclopropyl]-N-[(2S)-5-(1H-imidazol-2-yl)pentan-2-yl]prop-2-enamide |
| SMILES | COc1cccc(C2(c3cccc(OC)c3)C[C@@H]2C=CC(=O)N[C@@H](C)CCCc2ncc[nH]2)c1 |
| InChI | InChI=1S/C28H33N3O3/c1-20(7-4-12-26-29-15-16-30-26)31-27(32)14-13-23-19-28(23,21-8-5-10-24(17-21)33-2)22-9-6-11-25(18-22)34-3/h5-6,8-11,13-18,20,23H,4,7,12,19H2,1-3H3,(H,29,30)(H,31,32)/t20-,23-/m0/s1 |
| InChIKey | FCKHAYOTSZLBDK-REWPJTCUSA-N |
| XLogP | 4.82 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|