C29H33N3O3 — CID 57120987
3-[(1R)-2,2-bis(3-methoxyphenyl)cyclopropyl]-N-[(2S)-5-pyrimidin-5-ylpentan-2-yl]prop-2-enamide (PubChem CID 57120987) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is 3-[(1R)-2,2-bis(3-methoxyphenyl)cyclopropyl]-N-[(2S)-5-pyrimidin-5-ylpentan-2-yl]prop-2-enamide.
| Compound Name | 3-[(1R)-2,2-bis(3-methoxyphenyl)cyclopropyl]-N-[(2S)-5-pyrimidin-5-ylpentan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 57120987 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 3-[(1R)-2,2-bis(3-methoxyphenyl)cyclopropyl]-N-[(2S)-5-pyrimidin-5-ylpentan-2-yl]prop-2-enamide |
| SMILES | COc1cccc(C2(c3cccc(OC)c3)C[C@@H]2C=CC(=O)N[C@@H](C)CCCc2cncnc2)c1 |
| InChI | InChI=1S/C29H33N3O3/c1-21(7-4-8-22-18-30-20-31-19-22)32-28(33)14-13-25-17-29(25,23-9-5-11-26(15-23)34-2)24-10-6-12-27(16-24)35-3/h5-6,9-16,18-21,25H,4,7-8,17H2,1-3H3,(H,32,33)/t21-,25-/m0/s1 |
| InChIKey | XQGOMAGGIYBZEE-OFVILXPXSA-N |
| XLogP | 4.88 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|