C27H34N2O2 — CID 54187000
3-(6-methoxy-1-propyl-3,4-dihydronaphthalen-2-yl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]prop-2-enamide (PubChem CID 54187000) has the molecular formula C27H34N2O2 and a molecular weight of 418.58 g/mol. Its IUPAC name is 3-(6-methoxy-1-propyl-3,4-dihydronaphthalen-2-yl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]prop-2-enamide.
| Compound Name | 3-(6-methoxy-1-propyl-3,4-dihydronaphthalen-2-yl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 54187000 |
| Molecular Formula | C27H34N2O2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 3-(6-methoxy-1-propyl-3,4-dihydronaphthalen-2-yl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]prop-2-enamide |
| SMILES | CCCC1=C(C=CC(=O)N[C@H](C)CCCc2cccnc2)CCc2cc(OC)ccc21 |
| InChI | InChI=1S/C27H34N2O2/c1-4-7-25-22(11-12-23-18-24(31-3)14-15-26(23)25)13-16-27(30)29-20(2)8-5-9-21-10-6-17-28-19-21/h6,10,13-20H,4-5,7-9,11-12H2,1-3H3,(H,29,30)/t20-/m1/s1 |
| InChIKey | PFUAYIKJPWEFLK-HXUWFJFHSA-N |
| XLogP | 5.67 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|