C29H40N2O3 — CID 54150101
5-(2,6-dimethoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]undeca-2,4-dienamide (PubChem CID 54150101) has the molecular formula C29H40N2O3 and a molecular weight of 464.65 g/mol. Its IUPAC name is 5-(2,6-dimethoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]undeca-2,4-dienamide.
| Compound Name | 5-(2,6-dimethoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]undeca-2,4-dienamide |
|---|---|
| PubChem CID | 54150101 |
| Molecular Formula | C29H40N2O3 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | 5-(2,6-dimethoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]undeca-2,4-dienamide |
| SMILES | CCCCCCC(=CC=CC(=O)N[C@H](C)CCCc1cccnc1)c1c(OC)cccc1OC |
| InChI | InChI=1S/C29H40N2O3/c1-5-6-7-8-16-25(29-26(33-3)18-11-19-27(29)34-4)17-10-20-28(32)31-23(2)13-9-14-24-15-12-21-30-22-24/h10-12,15,17-23H,5-9,13-14,16H2,1-4H3,(H,31,32)/t23-/m1/s1 |
| InChIKey | OHDGOLNCGUXWSQ-HSZRJFAPSA-N |
| XLogP | 6.54 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|