C33H34N2O3 — CID 54167167
5-(4-methoxynaphthalen-2-yl)-5-(4-methoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide (PubChem CID 54167167) has the molecular formula C33H34N2O3 and a molecular weight of 506.65 g/mol. Its IUPAC name is 5-(4-methoxynaphthalen-2-yl)-5-(4-methoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide.
| Compound Name | 5-(4-methoxynaphthalen-2-yl)-5-(4-methoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 54167167 |
| Molecular Formula | C33H34N2O3 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 5-(4-methoxynaphthalen-2-yl)-5-(4-methoxyphenyl)-N-[(2R)-5-pyridin-3-ylpentan-2-yl]penta-2,4-dienamide |
| SMILES | COc1ccc(C(=CC=CC(=O)N[C@H](C)CCCc2cccnc2)c2cc(OC)c3ccccc3c2)cc1 |
| InChI | InChI=1S/C33H34N2O3/c1-24(9-6-10-25-11-8-20-34-23-25)35-33(36)15-7-14-30(26-16-18-29(37-2)19-17-26)28-21-27-12-4-5-13-31(27)32(22-28)38-3/h4-5,7-8,11-24H,6,9-10H2,1-3H3,(H,35,36)/t24-/m1/s1 |
| InChIKey | OSLQHPGGVXKBHA-XMMPIXPASA-N |
| XLogP | 6.77 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|