C30H35NO6 — CID 22155315
(2E)-5,5-bis(3,4-dimethoxyphenyl)-N-[5-(furan-3-yl)pentan-2-yl]penta-2,4-dienamide (PubChem CID 22155315) has the molecular formula C30H35NO6 and a molecular weight of 505.61 g/mol. Its IUPAC name is (2E)-5,5-bis(3,4-dimethoxyphenyl)-N-[5-(furan-3-yl)pentan-2-yl]penta-2,4-dienamide.
| Compound Name | (2E)-5,5-bis(3,4-dimethoxyphenyl)-N-[5-(furan-3-yl)pentan-2-yl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 22155315 |
| Molecular Formula | C30H35NO6 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | (2E)-5,5-bis(3,4-dimethoxyphenyl)-N-[5-(furan-3-yl)pentan-2-yl]penta-2,4-dienamide |
| SMILES | COc1ccc(C(=C/C=C/C(=O)NC(C)CCCc2ccoc2)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C30H35NO6/c1-21(8-6-9-22-16-17-37-20-22)31-30(32)11-7-10-25(23-12-14-26(33-2)28(18-23)35-4)24-13-15-27(34-3)29(19-24)36-5/h7,10-21H,6,8-9H2,1-5H3,(H,31,32)/b11-7+ |
| InChIKey | UKWFSTSDSPNZDB-YRNVUSSQSA-N |
| XLogP | 5.83 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|