C17H19NO4 — CID 90558341
(E)-3-(3,4-dimethoxyphenyl)-N-[2-(furan-3-yl)ethyl]prop-2-enamide (PubChem CID 90558341) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[2-(furan-3-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[2-(furan-3-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 90558341 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[2-(furan-3-yl)ethyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCCc2ccoc2)cc1OC |
| InChI | InChI=1S/C17H19NO4/c1-20-15-5-3-13(11-16(15)21-2)4-6-17(19)18-9-7-14-8-10-22-12-14/h3-6,8,10-12H,7,9H2,1-2H3,(H,18,19)/b6-4+ |
| InChIKey | SGTZFOYRVWRORL-GQCTYLIASA-N |
| XLogP | 2.67 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|