C26H26N2O — CID 14347364
(2Z)-5,5-diphenyl-N-(4-pyridin-3-ylbutyl)penta-2,4-dienamide (PubChem CID 14347364) has the molecular formula C26H26N2O and a molecular weight of 382.51 g/mol. Its IUPAC name is (2Z)-5,5-diphenyl-N-(4-pyridin-3-ylbutyl)penta-2,4-dienamide.
| Compound Name | (2Z)-5,5-diphenyl-N-(4-pyridin-3-ylbutyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 14347364 |
| Molecular Formula | C26H26N2O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (2Z)-5,5-diphenyl-N-(4-pyridin-3-ylbutyl)penta-2,4-dienamide |
| SMILES | O=C(/C=C\C=C(c1ccccc1)c1ccccc1)NCCCCc1cccnc1 |
| InChI | InChI=1S/C26H26N2O/c29-26(28-20-8-7-11-22-12-10-19-27-21-22)18-9-17-25(23-13-3-1-4-14-23)24-15-5-2-6-16-24/h1-6,9-10,12-19,21H,7-8,11,20H2,(H,28,29)/b18-9- |
| InChIKey | CTVPNMZQMXKFTB-NVMNQCDNSA-N |
| XLogP | 5.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|