C17H22O3 — CID 14347294
(2E,4Z)-5-(4-methoxyphenyl)deca-2,4-dienoic acid (PubChem CID 14347294) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (2E,4Z)-5-(4-methoxyphenyl)deca-2,4-dienoic acid.
| Compound Name | (2E,4Z)-5-(4-methoxyphenyl)deca-2,4-dienoic acid |
|---|---|
| PubChem CID | 14347294 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (2E,4Z)-5-(4-methoxyphenyl)deca-2,4-dienoic acid |
| SMILES | CCCCC/C(=C/C=C/C(=O)O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H22O3/c1-3-4-5-7-14(8-6-9-17(18)19)15-10-12-16(20-2)13-11-15/h6,8-13H,3-5,7H2,1-2H3,(H,18,19)/b9-6+,14-8- |
| InChIKey | FIAGRAQEOUVOSF-XPZLWBDUSA-N |
| XLogP | 4.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|