About 1,4-dimethoxybenzene;octan-3-one
1,4-dimethoxybenzene;octan-3-one (PubChem CID 174621330) has the molecular formula C16H26O3
and a molecular weight of 266.38 g/mol. Its IUPAC name is 1,4-dimethoxybenzene;octan-3-one.
Molecular Properties
| Compound Name | 1,4-dimethoxybenzene;octan-3-one |
| PubChem CID | 174621330 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 1,4-dimethoxybenzene;octan-3-one |
| SMILES | CCCCCC(=O)CC.COc1ccc(OC)cc1 |
| InChI | InChI=1S/C8H10O2.C8H16O/c1-9-7-3-5-8(10-2)6-4-7;1-3-5-6-7-8(9)4-2/h3-6H,1-2H3;3-7H2,1-2H3 |
| InChIKey | UWORVIOGNVERQT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethoxybenzene;octan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethoxybenzene;octan-3-one?
The IUPAC name of 1,4-dimethoxybenzene;octan-3-one (CID 174621330) is 1,4-dimethoxybenzene;octan-3-one.
What is the SMILES notation for 1,4-dimethoxybenzene;octan-3-one?
The canonical SMILES for 1,4-dimethoxybenzene;octan-3-one is CCCCCC(=O)CC.COc1ccc(OC)cc1.
What is the InChIKey of 1,4-dimethoxybenzene;octan-3-one?
The InChIKey is UWORVIOGNVERQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.C8H16O/c1-9-7-3-5-8(10-2)6-4-7;1-3-5-6-7-8(9)4-2/h3-6H,1-2H3;3-7H2,1-2H3.
What are the key properties of 1,4-dimethoxybenzene;octan-3-one?
1,4-dimethoxybenzene;octan-3-one has a molecular weight of 266.38 g/mol, XLogP of 4.25, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethoxybenzene;octan-3-one is sourced from PubChem (CID 174621330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).