C19H21N3O3 — CID 4692574
ethyl 7-[(2-amino-2-oxoethyl)-methylamino]-2-cyano-5-phenylhepta-2,4,6-trienoate (PubChem CID 4692574) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is ethyl 7-[(2-amino-2-oxoethyl)-methylamino]-2-cyano-5-phenylhepta-2,4,6-trienoate.
| Compound Name | ethyl 7-[(2-amino-2-oxoethyl)-methylamino]-2-cyano-5-phenylhepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 4692574 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | ethyl 7-[(2-amino-2-oxoethyl)-methylamino]-2-cyano-5-phenylhepta-2,4,6-trienoate |
| SMILES | CCOC(=O)C(C#N)=CC=C(C=CN(C)CC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C19H21N3O3/c1-3-25-19(24)17(13-20)10-9-16(15-7-5-4-6-8-15)11-12-22(2)14-18(21)23/h4-12H,3,14H2,1-2H3,(H2,21,23) |
| InChIKey | UXUIUBKGAHIHCD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|