C22H16ClN3O3S — CID 27276451
ethyl (2E,4Z)-5-(4-chlorophenyl)-2-cyano-5-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]penta-2,4-dienoate (PubChem CID 27276451) has the molecular formula C22H16ClN3O3S and a molecular weight of 437.91 g/mol. Its IUPAC name is ethyl (2E,4Z)-5-(4-chlorophenyl)-2-cyano-5-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]penta-2,4-dienoate.
| Compound Name | ethyl (2E,4Z)-5-(4-chlorophenyl)-2-cyano-5-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 27276451 |
| Molecular Formula | C22H16ClN3O3S |
| Molecular Weight | 437.91 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | ethyl (2E,4Z)-5-(4-chlorophenyl)-2-cyano-5-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]penta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C#N)=C/C=C(\Sc1nnc(-c2ccccc2)o1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H16ClN3O3S/c1-2-28-21(27)17(14-24)10-13-19(15-8-11-18(23)12-9-15)30-22-26-25-20(29-22)16-6-4-3-5-7-16/h3-13H,2H2,1H3/b17-10+,19-13- |
| InChIKey | AYWYNDMSGBALNV-HVFGMAQXSA-N |
| XLogP | 5.54 |
| TPSA | 89.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.91 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|