C19H15ClN2O2S — CID 5080890
ethyl 5-(4-chlorophenyl)-2-cyano-5-pyridin-2-ylsulfanylpenta-2,4-dienoate (PubChem CID 5080890) has the molecular formula C19H15ClN2O2S and a molecular weight of 370.86 g/mol. Its IUPAC name is ethyl 5-(4-chlorophenyl)-2-cyano-5-pyridin-2-ylsulfanylpenta-2,4-dienoate.
| Compound Name | ethyl 5-(4-chlorophenyl)-2-cyano-5-pyridin-2-ylsulfanylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 5080890 |
| Molecular Formula | C19H15ClN2O2S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | ethyl 5-(4-chlorophenyl)-2-cyano-5-pyridin-2-ylsulfanylpenta-2,4-dienoate |
| SMILES | CCOC(=O)C(C#N)=CC=C(Sc1ccccn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15ClN2O2S/c1-2-24-19(23)15(13-21)8-11-17(14-6-9-16(20)10-7-14)25-18-5-3-4-12-22-18/h3-12H,2H2,1H3 |
| InChIKey | APPIKBXVELDIMT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|