C24H23ClFN3O2 — CID 4986435
ethyl 5-(4-chlorophenyl)-2-cyano-5-[4-(4-fluorophenyl)piperazin-1-yl]penta-2,4-dienoate (PubChem CID 4986435) has the molecular formula C24H23ClFN3O2 and a molecular weight of 439.92 g/mol. Its IUPAC name is ethyl 5-(4-chlorophenyl)-2-cyano-5-[4-(4-fluorophenyl)piperazin-1-yl]penta-2,4-dienoate.
| Compound Name | ethyl 5-(4-chlorophenyl)-2-cyano-5-[4-(4-fluorophenyl)piperazin-1-yl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 4986435 |
| Molecular Formula | C24H23ClFN3O2 |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | ethyl 5-(4-chlorophenyl)-2-cyano-5-[4-(4-fluorophenyl)piperazin-1-yl]penta-2,4-dienoate |
| SMILES | CCOC(=O)C(C#N)=CC=C(c1ccc(Cl)cc1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H23ClFN3O2/c1-2-31-24(30)19(17-27)5-12-23(18-3-6-20(25)7-4-18)29-15-13-28(14-16-29)22-10-8-21(26)9-11-22/h3-12H,2,13-16H2,1H3 |
| InChIKey | WVHIJAMYZBXHNF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|