C14H15N3O — CID 99722458
(2E,4E)-2-cyano-5-(dimethylamino)-5-phenylpenta-2,4-dienamide (PubChem CID 99722458) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is (2E,4E)-2-cyano-5-(dimethylamino)-5-phenylpenta-2,4-dienamide.
| Compound Name | (2E,4E)-2-cyano-5-(dimethylamino)-5-phenylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 99722458 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | (2E,4E)-2-cyano-5-(dimethylamino)-5-phenylpenta-2,4-dienamide |
| SMILES | CN(C)/C(=C/C=C(\C#N)C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C14H15N3O/c1-17(2)13(11-6-4-3-5-7-11)9-8-12(10-15)14(16)18/h3-9H,1-2H3,(H2,16,18)/b12-8+,13-9+ |
| InChIKey | SQVPRZPJMZLJCJ-QHKWOANTSA-N |
| XLogP | 1.52 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|